
CAS 680622-71-3
:6-[[4-[(2-Propyn-1-yloxy)methyl]phenyl]methoxy]-9H-purin-2-amine
Description:
6-[[4-[(2-Propyn-1-yloxy)methyl]phenyl]methoxy]-9H-purin-2-amine, with CAS number 680622-71-3, is a synthetic organic compound that belongs to the class of purine derivatives. This compound features a purine core, which is a bicyclic structure composed of a fused imidazole and pyrimidine ring, characteristic of nucleobases found in DNA and RNA. The presence of a methoxy group and a propynyl ether moiety contributes to its unique chemical properties, potentially influencing its solubility and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests potential interactions with biological targets, possibly serving as a lead compound for further modifications. As with many synthetic compounds, its stability, reactivity, and biological effects would depend on various factors, including pH, temperature, and the presence of other chemical species. Proper handling and safety measures should be observed when working with this substance in a laboratory setting.
Formula:C16H15N5O2
InChI:InChI=1S/C16H15N5O2/c1-2-7-22-8-11-3-5-12(6-4-11)9-23-15-13-14(19-10-18-13)20-16(17)21-15/h1,3-6,10H,7-9H2,(H3,17,18,19,20,21)
InChI key:InChIKey=LZDBKQCASZCNSH-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(COCC#C)C=C1)C2=C3C(=NC(N)=N2)N=CN3
Synonyms:- 1H-Purin-2-amine, 6-[[4-[(2-propynyloxy)methyl]phenyl]methoxy]-
- 6-[[4-[(2-Propyn-1-yloxy)methyl]phenyl]methoxy]-9H-purin-2-amine
- 9H-Purin-2-amine, 6-[[4-[(2-propyn-1-yloxy)methyl]phenyl]methoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
PYBG
CAS:PYBG is a protein-based analog that has been developed as an anticancer agent. It works by inhibiting specific kinases that play a role in cancer cell growth and survival. PYBG has shown potent activity against various types of cancer cells, including those from human origin. In Chinese medicinal practices, PYBG has been used to treat urinary tract infections and other ailments. This protein-based inhibitor has also been found to induce apoptosis in cancer cells, leading to the death of these cells and preventing the progression of tumors. PYBG is a promising new therapy for cancer treatment due to its ability to disrupt the cell cycle and inhibit tumor growth.Formula:C16H15N5O2Purity:Min. 95%Molecular weight:309.32 g/molPYBG
CAS:PYBG serves as a flexible precursor for facile conjugation with diverse fluorescent dyes using 'Click chemistry' and Sonogashira coupling reactions.Formula:C16H15N5O2Color and Shape:SolidMolecular weight:309.329



