CAS 6807-82-5
:N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-alpha-glutamyl-L-glutamic acid
Description:
N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-alpha-glutamyl-L-glutamic acid, with CAS number 6807-82-5, is a complex organic compound characterized by its multi-functional structure, which includes amino acids and a pteridine derivative. This substance features a pteridinyl moiety, which is known for its role in various biological processes, particularly in the context of folate metabolism and enzyme activity. The presence of L-alpha-glutamyl and L-glutamic acid residues suggests potential applications in biochemistry and pharmaceuticals, particularly in drug design and delivery systems. The compound may exhibit properties such as solubility in polar solvents, stability under physiological conditions, and potential interactions with biological macromolecules. Its intricate structure may also confer specific biological activities, making it of interest in research related to enzyme inhibition or modulation. Overall, this compound represents a significant intersection of organic chemistry and biochemistry, with potential implications in therapeutic applications.
Formula:C24H26N8O9
InChI:InChI=1/C24H26N8O9/c25-24-31-19-18(22(39)32-24)28-13(10-27-19)9-26-12-3-1-11(2-4-12)20(37)29-14(5-7-16(33)34)21(38)30-15(23(40)41)6-8-17(35)36/h1-4,10,14-15,26H,5-9H2,(H,29,37)(H,30,38)(H,33,34)(H,35,36)(H,40,41)(H3,25,27,31,32,39)/t14-,15-/m0/s1
Synonyms:- Pteroyldiglutamic Acid
- N-(4-{[(2-Amino-4-hydroxypteridin-6-yl)methyl]amino}benzoyl)-L-alpha-glutamyl-L-glutamic acid
- N-[N-[4-[[(2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-a-glutamyl]-L-glutamic Acid
- 6807-82-5
- PDGA
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
