
CAS 6807-96-1
:Versicolorin A
Description:
Versicolorin A is a secondary metabolite produced by certain fungi, particularly those belonging to the genus Aspergillus. It is classified as a polyketide and is known for its distinctive yellow pigment, which contributes to the coloration of fungal cultures. The compound has a complex molecular structure characterized by multiple rings and functional groups, which contribute to its biological activity. Versicolorin A exhibits antifungal properties and has been studied for its potential applications in agriculture and medicine. Its biosynthesis involves a series of enzymatic reactions, highlighting the intricate metabolic pathways in fungi. Additionally, Versicolorin A has been investigated for its role in the pathogenicity of certain fungal species, as well as its potential as a natural dye. The compound's stability and solubility in various solvents make it a subject of interest in both research and industrial applications. Overall, Versicolorin A exemplifies the diverse chemical nature of fungal metabolites and their significance in ecological and biotechnological contexts.
Formula:C18H10O7
InChI:InChI=1S/C18H10O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h1-5,7,18-20,23H/t7-,18+/m0/s1
InChI key:InChIKey=SJNDYXPJRUTLNW-ULCDLSAGSA-N
SMILES:OC1=C2C(=CC3=C1C(=O)C=4C(C3=O)=CC(O)=CC4O)O[C@@]5([C@]2(C=CO5)[H])[H]
Synonyms:- Anthra[2,3-b]furo[3,2-d]furan-5,10-dione, 3a,12a-dihydro-4,6,8-trihydroxy-, (3aS,12aR)-
- Anthra[2,3-b]furo[3,2-d]furan-5,10-dione, 3a,12a-dihydro-4,6,8-trihydroxy-, (3aS-cis)-
- Versicolorin
- Versicolorin A
- (3aS,12aR)-3a,12a-Dihydro-4,6,8-trihydroxyanthra[2,3-b]furo[3,2-d]furan-5,10-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Versicolorin A
CAS:Versicolorin A is a potential indicator of aflatoxin contamination in corn stored in granary.Formula:C18H10O7Color and Shape:SolidMolecular weight:338.27
