CymitQuimica logo

CAS 68077-28-1

:

1-Propene-1,2,3-tricarboxylic acid, triethyl ester, (E)-

Description:
1-Propene-1,2,3-tricarboxylic acid, triethyl ester, commonly referred to by its CAS number 68077-28-1, is an organic compound characterized by its structure, which includes a propene backbone with three carboxylic acid groups esterified with ethyl groups. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of multiple carboxyl groups, which can participate in various chemical reactions, including esterification and polymerization. It is often utilized in the synthesis of polymers and as a plasticizer due to its ability to enhance flexibility and durability in materials. Additionally, the (E)-configuration indicates the specific geometric arrangement of substituents around the double bond, which can influence the compound's physical and chemical properties. Safety data sheets should be consulted for handling and storage guidelines, as it may pose health risks if not managed properly. Overall, this compound plays a significant role in industrial applications, particularly in the production of specialty chemicals and materials.
Formula:C12H18O6
InChI:InChI=1S/C12H18O6/c1-4-16-10(13)7-9(12(15)18-6-3)8-11(14)17-5-2/h7H,4-6,8H2,1-3H3/b9-7+
InChI key:InChIKey=IDDWGDKSBYYEPL-VQHVLOKHSA-N
SMILES:C(\CC(OCC)=O)(=C\C(OCC)=O)/C(OCC)=O
Synonyms:
  • 1-Propene-1,2,3-tricarboxylic acid, triethyl ester, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.