CAS 68078-09-1

1-Methylpyrrolidine-2-carboxylic acid

Description:

1-Methylpyrrolidine-2-carboxylic acid, also known as a derivative of pyrrolidine, is an organic compound characterized by its five-membered ring structure containing a nitrogen atom. This compound features a carboxylic acid functional group, which imparts acidic properties, and a methyl group attached to the nitrogen, influencing its reactivity and solubility. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the carboxylic acid group allows for hydrogen bonding, enhancing its solubility in polar solvents such as water and alcohols. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest potential applications in the synthesis of various chemical intermediates or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₆H₁₁NO₂

InChI: InChI=1S/C6H11NO2/c1-7-4-2-3-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)

SMILES: CN1CCCC1C(=O)O

Synonyms:

• 1-Methylproline
• Proline, 1-methyl

1-Methylproline

CAS: 68078-09-1

Formula: C₆H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 129.1570

Ref: IN-DA00FBFI

1-Methyl-DL-proline

CAS: 68078-09-1

1-Methyl-DL-proline

Purity: 97%

Molecular weight: 129.16g/mol

Ref: 54-OR938983

1-Methyl-pyrrolidine-2-carboxylic acid

CAS: 68078-09-1

Formula: C₆H₁₁NO₂

Purity: 97%

Color and Shape: White powder

Molecular weight: 129.159

Ref: 10-F088245