
CAS 68083-58-9
:Benzenepropanol, α,γ,γ-trimethyl-, 1-acetate
Description:
Benzenepropanol, α,γ,γ-trimethyl-, 1-acetate, with the CAS number 68083-58-9, is an organic compound characterized by its aromatic structure and ester functional group. This compound features a benzene ring substituted with a propanol moiety that has three methyl groups at the α and γ positions, contributing to its branched structure. The presence of the acetate group indicates that it is an ester, which typically imparts certain properties such as volatility and solubility in organic solvents. The compound is likely to exhibit a pleasant, sweet odor, characteristic of many aromatic esters, making it potentially useful in flavoring and fragrance applications. Its molecular structure suggests that it may have moderate to low toxicity, but specific safety data should be consulted for handling and usage. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by its molecular weight and the presence of functional groups, which are important for its applications in various chemical processes and industries.
Formula:C14H20O2
InChI:InChI=1S/C14H20O2/c1-11(16-12(2)15)10-14(3,4)13-8-6-5-7-9-13/h5-9,11H,10H2,1-4H3
InChI key:InChIKey=MXIGGIZQUGDKAP-UHFFFAOYSA-N
SMILES:C(CC(OC(C)=O)C)(C)(C)C1=CC=CC=C1
Synonyms:- 4-Methyl-4-phenylpentan-2-yl acetate
- 2-Pentanol, 4-methyl-4-phenyl-, acetate
- Vetikolacetate
- Benzenepropanol, α,γ,γ-trimethyl-, acetate
- Benzenepropanol, α,γ,γ-trimethyl-, 1-acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Vetikolacetate
CAS:Vetikolacetate is an analog of a medicinal plant compound that has been shown to have anticancer properties. It is a kinase inhibitor that selectively targets kinases involved in cancer cell growth and survival. Vetikolacetate has been found to induce apoptosis in human cancer cells, including Chinese hamster ovary cells. This compound has also demonstrated inhibitory effects on the growth of tumors in mice models. Vetikolacetate may be a promising candidate for the development of novel anticancer drugs due to its potent activity against cancer cells and its ability to inhibit specific kinases involved in cancer progression.
Formula:C14H20O2Purity:Min. 95%Molecular weight:220.31 g/mol
