CAS 681001-30-9

(3R)-8-hydroxy-3-methyl-1,2,3,4-tetrahydrotetraphene-7,12-dione

Description:

(3R)-8-hydroxy-3-methyl-1,2,3,4-tetrahydrotetraphene-7,12-dione, with the CAS number 681001-30-9, is a chemical compound characterized by its complex polycyclic structure, which includes multiple fused aromatic rings. This compound features hydroxyl (-OH) and carbonyl (C=O) functional groups, contributing to its potential reactivity and biological activity. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. The methyl group attached to the tetrahydrotetraphene framework can affect the compound's steric properties and overall stability. Additionally, the dione functionality indicates that it may participate in various chemical reactions, such as oxidation or reduction processes. The stereochemistry denoted by the (3R) configuration implies specific spatial arrangements of atoms, which can significantly impact the compound's properties and interactions. Overall, this compound may have applications in fields such as organic synthesis, medicinal chemistry, or materials science, although specific applications would depend on further research and characterization.

Formula: C₁₉H₁₆O₃

InChI: InChI=1/C19H16O3/c1-10-5-7-12-11(9-10)6-8-14-16(12)18(21)13-3-2-4-15(20)17(13)19(14)22/h2-4,6,8,10,20H,5,7,9H2,1H3/t10-/m1/s1

SMILES: C[C@@H]1CCc2c(ccc3c2C(=O)c2cccc(c2C3=O)O)C1

(R)-8-Hydroxy-3-methyl-1,2,3,4-tetrahydrobenz[a]anthracene-7,12-dione

Controlled Product

CAS: 681001-30-9

Applications (R)-8-Hydroxy-3-methyl-1,2,3,4-tetrahydrobenz[a]anthracene-7,12-dione (cas# 681001-30-9) is a compound useful in organic synthesis.

Formula: C₁₉H₁₆O₃

Color and Shape: Neat

Molecular weight: 292.33

Ref: TR-H948360