CAS 68104-62-1
:Piperazine, 1-(4-bromophenyl)-, hydrochloride (1:1)
Description:
Piperazine, 1-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 4-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the para position, contributing to the compound's unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. This compound may exhibit biological activity, potentially acting as a pharmacological agent, and is often studied for its effects on the central nervous system. Its molecular structure allows for interactions with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, Piperazine, 1-(4-bromophenyl)-, hydrochloride (1:1) is a notable compound in the realm of organic chemistry and drug development.
Formula:C10H13BrN2·ClH
InChI:InChI=1S/C10H13BrN2.ClH/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H
InChI key:InChIKey=YDVSFRZKQMQPJD-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=C1)N2CCNCC2.Cl
Synonyms:- 1-(4-Bromophenyl)Piperazine Hcl
- 1-(4-Bromophenyl)piperazine hydrochloride
- 4-(4-Bromophenyl)Piperazin-1-Ium Chloride
- Piperazine, 1-(4-bromophenyl)-, hydrochloride (1:1)
- Piperazine, 1-(4-bromophenyl)-, monohydrochloride
- 1-(4-Bromophenyl)piperazine monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(4-Bromophenyl)piperazine, HCl
CAS:Formula:C10H14BrClN2Purity:97%Color and Shape:SolidMolecular weight:277.58861-(4-Bromophenyl)piperazine hydrochloride
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:277.58999633789061-(4-Bromophenyl)piperazine hydrochloride
CAS:Controlled Product1-(4-Bromophenyl)piperazine hydrochloride is a linker that binds to serotonin receptors. It has been shown to inhibit the reuptake of serotonin, which may lead to an increase in the neurotransmitter's level in the synaptic cleft. The compound also inhibits the production of 5-hydroxytryptamine and other monoamine neurotransmitters, which can lead to anaphylactic reactions in humans.Formula:C10H14BrClN2Purity:Min. 95%Molecular weight:277.59 g/mol1-(4-Bromophenyl)piperazine Hydrochloride
CAS:Controlled ProductApplications 1-(4-Bromophenyl)piperazine Hydrochloride is useful in the synthesis of large bifunctional heterocycles use in targeted degradation of rapidly accelerated fibrosarcoma polypeptides
References Crew, A., et al.: U.S. Pat. Appl. Publ., 1094 (2020)Formula:C10H13BrN2·ClHColor and Shape:NeatMolecular weight:277.5891-(4-Bromophenyl)piperazine (hydrochloride)
CAS:1-(4-Bromophenyl)piperazine (hydrochloride) is a useful organic compound for research related to life sciences. The catalog number is T65071 and the CAS number is 68104-62-1.Formula:C10H14BrClN2Color and Shape:SolidMolecular weight:277.59





