CAS 6811-77-4

1H-imidazo[4,5-c]pyridin-4-amine

Description:

1H-imidazo[4,5-c]pyridin-4-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features an amino group (-NH2) at the 4-position of the pyridine ring, which contributes to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The structure of 1H-imidazo[4,5-c]pyridin-4-amine allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique ring system can participate in hydrogen bonding and π-π stacking interactions, which are crucial for biological activity. Additionally, this compound may exhibit properties such as fluorescence or photostability, depending on its environment. Overall, 1H-imidazo[4,5-c]pyridin-4-amine is a versatile compound with potential applications in drug discovery and development.

Formula: C₆H₆N₄

InChI: InChI=1/C6H6N4/c7-6-5-4(1-2-8-6)9-3-10-5/h1-3H,(H2,7,8)(H,9,10)

SMILES: c1c[nH]c(=N)c2c1nc[nH]2

Synonyms:

• 3H-Imidazo[4,5-c]pyridin-4-amine

1H-Imidazo[4,5-c]pyridin-4-amine

CAS: 6811-77-4

Formula: C₆H₆N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.1386

Ref: IN-DA005MRF

4-Amino-3H-imidazo[4,5-c]pyridine

CAS: 6811-77-4

4-Amino-3H-imidazo[4,5-c]pyridine

Formula: C₆H₆N₄

Purity: 97%

Color and Shape: white solid

Molecular weight: 134.14g/mol

Ref: 54-OR305581

1H-Imidazo[4,5-c]pyridin-4-amine

CAS: 6811-77-4

Formula: C₆H₆N₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 134.142

Ref: 10-F235167