CAS 68112-21-0
:3,5-dibutyl-2-hydroxy-6-(6-oxoundecan-5-yl)-4H-pyran-4-one
Description:
3,5-Dibutyl-2-hydroxy-6-(6-oxoundecan-5-yl)-4H-pyran-4-one, with the CAS number 68112-21-0, is a chemical compound characterized by its complex structure, which includes a pyran ring, hydroxyl group, and multiple butyl substituents. This compound is likely to exhibit properties typical of pyranones, such as potential antioxidant and antimicrobial activities, due to the presence of the hydroxyl group and the conjugated system within the pyran ring. The long aliphatic chain (6-oxoundecan-5-yl) may influence its solubility and lipophilicity, making it more soluble in organic solvents than in water. The presence of multiple butyl groups suggests that it may have a relatively high molecular weight and could exhibit hydrophobic characteristics. Additionally, the compound's structure may allow for various chemical reactivity, including potential for further functionalization or interaction with biological systems. Overall, this compound's unique features may make it of interest in fields such as medicinal chemistry, materials science, or as a potential additive in various applications.
Formula:C24H40O4
InChI:InChI=1/C24H40O4/c1-5-9-13-17-21(25)18(14-10-6-2)23-19(15-11-7-3)22(26)20(16-12-8-4)24(27)28-23/h18,27H,5-17H2,1-4H3
SMILES:CCCCCC(=O)C(CCCC)c1c(CCCC)c(=O)c(CCCC)c(O)o1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Elasnin
CAS:<p>Elasnin is a reversible inhibitor of elastase for human granulocyte and pancreatic enzymes with IC50 values of 1.3 and 30 µg/ml, respectively.</p>Formula:C24H40O4Color and Shape:SolidMolecular weight:392.57
