CAS 681126-45-4

6-bromo-4-methyl-1,3-benzothiazol-2-amine

Description:

6-Bromo-4-methyl-1,3-benzothiazol-2-amine is an organic compound characterized by its unique structure, which includes a benzothiazole ring system. This compound features a bromine atom and a methyl group attached to the benzothiazole framework, contributing to its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. The presence of the amine functional group suggests that it can participate in hydrogen bonding, influencing its interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Additionally, its bromine substituent can enhance its reactivity in electrophilic aromatic substitution reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₇BrN₂S

InChI: InChI=1/C8H7BrN2S/c1-4-2-5(9)3-6-7(4)11-8(10)12-6/h2-3H,1H3,(H2,10,11)

SMILES: Cc1cc(cc2c1[nH]c(=N)s2)Br

Synonyms:

• 2-Benzothiazolamine, 6-bromo-4-methyl-

2-Amino-6-bromo-4-methylbenzo[d]thiazole

CAS: 681126-45-4

Formula: C₈H₇BrN₂S

Purity: 97%

Molecular weight: 243.1236

Ref: IN-DA006F2T

2-Amino-6-bromo-4-methylbenzothiazole

CAS: 681126-45-4

Formula: C₈H₇BrN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.12

Ref: 10-F033462

2-Amino-6-bromo-4-methylbenzothiazole

CAS: 681126-45-4

2-Amino-6-bromo-4-methylbenzothiazole is a heterocyclic compound that has been shown to be an efficient catalyst for the cyclization of α,β-unsaturated aldehydes. It reacts with pyridinium salts in ionic liquids at room temperature and yields high yields of 4-hydroxycoumarin. This heterocycle has also been used as a pharmacological probe. 2-Amino-6-bromo-4-methylbenzothiazole is an acid and can serve as a mediator for reactions involving aldehydes, which are often difficult to react with other reagents. The reaction time for this heterocycle is short and it does not require any special operational conditions.

Formula: C₈H₇BrN₂S

Purity: Min. 95%

Molecular weight: 243.12 g/mol

Ref: 3D-GCB12645