CymitQuimica logo

CAS 681128-38-1

:

Ethyl 3,3-difluorocyclobutanecarboxylate

Description:
Ethyl 3,3-difluorocyclobutanecarboxylate is an organic compound characterized by its unique structure, which includes a cyclobutane ring substituted with two fluorine atoms and an ethyl ester functional group. The presence of the difluoromethyl group enhances its reactivity and may influence its physical properties, such as boiling point and solubility. Typically, compounds like this exhibit moderate polarity due to the ester functional group, which can affect their interactions in various chemical environments. The cyclobutane ring contributes to the compound's strain and rigidity, potentially impacting its reactivity in chemical reactions. Ethyl 3,3-difluorocyclobutanecarboxylate may find applications in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their biological activity and stability. Safety data and handling precautions should be observed, as with any fluorinated compound, due to potential toxicity and environmental concerns associated with fluorinated substances.
Formula:C7H10F2O2
InChI:InChI=1S/C7H10F2O2/c1-2-11-6(10)5-3-7(8,9)4-5/h5H,2-4H2,1H3
InChI key:YSXYNSJJESDMJF-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CC(C1)(F)F
Found 4 products.