CAS 6812-14-2
:naphtho[3,2-f]isobenzofuran-1,3-dione
Description:
Naphtho[3,2-f]isobenzofuran-1,3-dione, also known by its CAS number 6812-14-2, is an organic compound characterized by its complex polycyclic structure, which includes fused naphthalene and isobenzofuran moieties. This compound typically exhibits a deep color, often appearing as a dark solid or crystalline material. It is known for its potential applications in organic electronics, particularly in organic semiconductors and dyes, due to its conjugated system that allows for effective light absorption and electron mobility. The compound is also of interest in the field of organic synthesis and materials science. Its reactivity is influenced by the presence of the dione functional groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, naphtho[3,2-f]isobenzofuran-1,3-dione may exhibit interesting photophysical properties, making it a subject of study in photochemistry and photophysics. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C16H8O3
InChI:InChI=1/C16H8O3/c17-15-13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14(13)16(18)19-15/h1-8H
SMILES:c1ccc2cc3cc4c(cc3cc2c1)C(=O)OC4=O
Synonyms:- Anthra[2,3-c]furan-1,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Anthracenedicarboxylic Anhydride
CAS:Formula:C16H8O3Purity:>93.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:248.242,3-Anthracenedicarboxylic anhydride
CAS:2,3-Anthracenedicarboxylic anhydride is a chemical compound that belongs to the homologues of ethyl esters. It is used as a supramolecular building block and can be synthesized by reacting tetraethylammonium with methyl ethyl acetate in acetonitrile. 2,3-Anthracenedicarboxylic anhydride has been shown to have multidrug resistance properties and can be found in fatty acids, polyunsaturated fatty acids, and natural substances such as anthracene. This compound also has biosynthesis properties and is involved in the disassembly of biomolecules.Formula:C16H8O3Purity:90%MinMolecular weight:248.24 g/mol



