CAS 6812-87-9
:Royleanone
Description:
Royleanone, with the CAS number 6812-87-9, is a naturally occurring chemical compound classified as a sesquiterpenoid. It is primarily derived from various plant species, particularly those in the Lamiaceae family, such as rosemary. This compound is known for its distinctive aromatic properties, contributing to the fragrance of the plants from which it is extracted. Royleanone exhibits potential biological activities, including antimicrobial and antioxidant properties, making it of interest in both pharmaceutical and cosmetic applications. Its molecular structure features a complex arrangement of carbon and hydrogen atoms, typical of sesquiterpenoids, which often exhibit diverse biological effects. Additionally, Royleanone's stability and solubility characteristics can vary depending on the solvent used, influencing its application in formulations. Research continues to explore its potential health benefits and uses in various industries, highlighting the importance of natural compounds in developing new therapeutic agents.
Formula:C20H28O3
InChI:InChI=1S/C20H28O3/c1-11(2)14-16(21)12-7-8-13-19(3,4)9-6-10-20(13,5)15(12)18(23)17(14)22/h11,13,22H,6-10H2,1-5H3/t13-,20-/m0/s1
InChI key:InChIKey=KZAPVZIQILABNM-RBZFPXEDSA-N
SMILES:C[C@@]12C3=C(C(=O)C(C(C)C)=C(O)C3=O)CC[C@]1(C(C)(C)CCC2)[H]
Synonyms:- (4bS,8aS)-4b,5,6,7,8,8a,9,10-Octahydro-3-hydroxy-4b,8,8-trimethyl-2-(1-methylethyl)-1,4-phenanthrenedione
- 1,4-Phenanthrenedione, 4b,5,6,7,8,8a,9,10-octahydro-3-hydroxy-4b,8,8-trimethyl-2-(1-methylethyl)-, (4bS,8aS)-
- 1,4-Phenanthrenedione, 4b,5,6,7,8,8a,9,10-octahydro-3-hydroxy-4b,8,8-trimethyl-2-(1-methylethyl)-, (4bS-trans)-
- 14-Hydroxyabieta-8,13-Diene-11,12-Dione
- NSC 122417
- Podocarpa-8,12-diene-11,14-dione, 12-hydroxy-13-isopropyl-
- Royleanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenan threne-3,4-dione
CAS:Formula:C20H28O3Color and Shape:SolidMolecular weight:316.4345Royleanone
CAS:Royleanone possesses cytotoxic activity against the human pancreatic cancer cell line MIA PaCa-2.Formula:C20H28O3Color and Shape:SolidMolecular weight:316.441Royleanone
CAS:Controlled ProductRoyleanone is a natural compound that belongs to the diterpene family and has been shown to have potent anticancer effects on prostate cancer cells. Royleanone inhibits mitochondrial membrane depolarization and anti-cancer properties by inhibiting the synthesis of fatty acids. Royleanone also inhibits cell proliferation, induces cell death, and reduces the mitochondrial membrane potential in prostate cancer cells. It is able to inhibit tumor growth in vivo by inducing apoptosis. Royleanone also shows an ability to maintain or improve insulin sensitivity in diabetic patients when administered orally.
Formula:C20H28O3Purity:Min. 95%Color and Shape:PowderMolecular weight:316.44 g/mol



