CymitQuimica logo

CAS 68120-72-9

:

1-Pentanone, 1-(3,4-dichlorophenyl)-

Description:
1-Pentanone, 1-(3,4-dichlorophenyl)-, also known by its CAS number 68120-72-9, is an organic compound characterized by its ketone functional group and a pentane backbone. This substance features a phenyl group substituted with two chlorine atoms at the 3 and 4 positions, which significantly influences its chemical properties and reactivity. Typically, it appears as a colorless to pale yellow liquid with a distinctive odor. The presence of the dichlorophenyl group enhances its lipophilicity, making it more soluble in organic solvents than in water. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the presence of the chlorine substituents. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 1-Pentanone, 1-(3,4-dichlorophenyl)- is a notable compound in the field of organic chemistry with diverse applications.
Formula:C11H12Cl2O
InChI:InChI=1S/C11H12Cl2O/c1-2-3-4-11(14)8-5-6-9(12)10(13)7-8/h5-7H,2-4H2,1H3
InChI key:DAQIQOIKLVJWKH-UHFFFAOYSA-N
SMILES:CCCCC(=O)C1=CC(=C(C=C1)Cl)Cl
Synonyms:
  • 1-(3,4-Dichloro-Phenyl)-Pentan-1-One
  • 3',4'-Dichlorovalerophenone
Found 4 products.