CAS 68127-22-0
:5-Oxo-D-proline (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester
Description:
5-Oxo-D-proline (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, identified by its CAS number 68127-22-0, is a chemical compound that belongs to the class of proline derivatives. This substance features a cyclic structure, characterized by a five-membered lactam ring, which is a hallmark of proline derivatives. The presence of the oxo group indicates that it has a carbonyl functional group, contributing to its reactivity and potential applications in organic synthesis. The specific stereochemistry denoted by the (1R,2S,5R) configuration suggests that the compound exhibits chirality, which can influence its biological activity and interactions with other molecules. Additionally, the presence of the cyclohexyl ester moiety suggests that it may have lipophilic properties, potentially affecting its solubility and permeability in biological systems. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features and potential biological activities.
Formula:C15H25NO3
InChI:InChI=1S/C15H25NO3/c1-9(2)11-5-4-10(3)8-13(11)19-15(18)12-6-7-14(17)16-12/h9-13H,4-8H2,1-3H3,(H,16,17)/t10-,11+,12-,13-/m1/s1
InChI key:InChIKey=SLHPMAOXNSLXEH-YVECIDJPSA-N
SMILES:C(C)(C)[C@H]1[C@H](OC(=O)[C@@H]2NC(=O)CC2)C[C@H](C)CC1
Synonyms:- (-)-Menthyl (+)-2-pyrrolidone-5-carboxylate
- (1R-(1alpha,2beta,5alpha))-2-Isopropyl-5-methylcyclohexyl 5-oxo-D-prolinate
- 5-Methyl-2-(Propan-2-Yl)Cyclohexyl 5-Oxoprolinate
- 5-Oxo-<span class="text-smallcaps">D</span>-proline (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester
- <span class="text-smallcaps">D</span>-Proline, 5-oxo-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester
- <span class="text-smallcaps">D</span>-Proline, 5-oxo-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-(1α,2β,5α)]-
- D-Proline, 5-oxo-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester
- D-Proline, 5-oxo-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-(1α,2β,5α)]-
- 5-Oxo-D-proline (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2S,5R)-Menthyl (R)-Pyroglutamate
CAS:Controlled ProductFormula:C15H25NO3Color and Shape:NeatMolecular weight:267.364
