CAS 68127-59-3
:cis-Cyhalothric acid
Description:
Cis-Cyhalothric acid, with the CAS number 68127-59-3, is a chemical compound belonging to the class of pyrethroids, which are synthetic analogs of natural pyrethrins. This substance is characterized by its insecticidal properties, making it effective against a wide range of pests. It typically exhibits a high degree of stability in the environment, which contributes to its efficacy as a pesticide. The compound is known for its neurotoxic effects on insects, disrupting their nervous system and leading to paralysis and death. In terms of physical properties, cis-Cyhalothric acid is generally a solid at room temperature and may have low solubility in water, but it is more soluble in organic solvents. Its use is regulated in many countries due to potential environmental and health impacts, necessitating careful handling and application. Additionally, it is important to consider its toxicity to non-target organisms, including beneficial insects and aquatic life, when assessing its environmental footprint.
Formula:C9H10ClF3O2
InChI:InChI=1/C9H10ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h3-4,6H,1-2H3,(H,14,15)/b5-3-/t4-,6-/s2
InChI key:InChIKey=SPVZAYWHHVLPBN-HPDTXNCCNA-N
SMILES:C(=C(/C(F)(F)F)\Cl)\[C@H]1[C@@H](C(O)=O)C1(C)C
Synonyms:- Cyclopropanecarboxylic acid, 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethyl-, [1α,3α(Z)]-(±)-
- rel-(1R,3R)-3-[(1Z)-2-Chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethylcyclopropanecarboxylic acid
- (±)-Cyhalothric acid
- Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethyl-, (1R,3R)-rel-
- Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (1R,3R)-rel-
- Cyhalothrin Impurity 22
- (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid
- (Z)-(1RS,3RS)-3-(2-Chloro-3,3,3-trifluoroprope- nyl)-2,2-dimethylcyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(±)-Cyhalothric Acid
CAS:Controlled ProductApplications (±)-Cyhalothric acid (CAS# 68127-59-3) is a useful research chemical compound.
Formula:C9H10ClF3O2Color and Shape:NeatMolecular weight:242.6227(±)-Cyhalothric acid
CAS:(±)-Cyhalothric acid is an organic compound that belongs to the class of l-tartaric acids. It is a reactive molecule, which can be synthesized from (±)-cyhalothrin, an insecticide. Cyhalothric acid has been used in the synthesis of monoclonal and polyclonal antibodies as a reactant for antigen binding. The optimal reaction conditions for this compound are hydrochloric acid at 0°C to room temperature. Inorganic acids such as trifluoroacetic acid may cause undesired side reactions, such as hydrolysis of cyhalothric acid.Formula:C9H10ClF3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:242.62 g/mol



