CAS 6813-21-4
:Selina-3,7(11)-diene
Description:
Selina-3,7(11)-diene is a naturally occurring organic compound classified as a sesquiterpene, which is a type of terpene made up of three isoprene units. It is characterized by its unique bicyclic structure, which contributes to its distinct physical and chemical properties. This compound typically exhibits a colorless to pale yellow appearance and has a characteristic odor. Selina-3,7(11)-diene is known for its role in various biological activities, including potential antimicrobial and anti-inflammatory properties. It is often found in essential oils and plant extracts, particularly in certain species of the Asteraceae family. The compound's reactivity is influenced by the presence of double bonds in its structure, making it susceptible to various chemical reactions, such as oxidation and polymerization. Additionally, Selina-3,7(11)-diene can be used as a building block in organic synthesis and may have applications in the fragrance and flavor industries due to its aromatic qualities. Overall, its unique structure and properties make it a subject of interest in both natural product chemistry and industrial applications.
Formula:C15H24
InChI:InChI=1/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,14H,5,7-10H2,1-4H3/t14-,15+/m0/s1
InChI key:InChIKey=WNRBYZQFEBIUGD-LSDHHAIUSA-N
SMILES:C[C@]12[C@@](CC(=C(C)C)CC1)(C(C)=CCC2)[H]
Synonyms:- (4aR,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-2-(1-methylethylidene)naphthalene
- (4aR,8aR)-2-isopropylidene-4a,8-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene
- (4aR,8aR)-4a,8-dimethyl-2-(propan-2-ylidene)-1,2,3,4,4a,5,6,8a-octahydronaphthalene
- Eudesma-3,7(11)-diene
- Naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-2-(1-methylethylidene)-, (4aR-trans)-
- Selina-3,7(11)-diene
- naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-2-(1-methylethylidene)-, (4aR,8aR)-
- (4aR)-3,4,4a,5,6,7,8,8aα-Octahydro-1,4aβ-dimethyl-7-(1-methylethylidene)naphthalene
- 3,7(11)-Eudesmadiene
- 3,7(11)-Selinadiene
- (4aR)-1,2,3,4,4a,5,6,8aβ-Octahydro-4aα,8-dimethyl-2-(1-methylethylidene)naphthalene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Selina-3,7(11)-diene
CAS:Controlled ProductFormula:C15H24Color and Shape:ColourlessMolecular weight:204.35Selina-3,7(11)-diene
CAS:<p>Selina-3,7(11)-diene is an analog of a natural compound found in Chinese medicinal herbs that has shown promising anticancer properties. This compound has been shown to inhibit the activity of certain kinases, which are enzymes involved in cell signaling pathways that regulate cell growth and division. Selina-3,7(11)-diene has been found to induce apoptosis (programmed cell death) in human cancer cells and may have potential as a therapeutic agent for the treatment of various types of tumors. Additionally, this compound has been detected in human urine and may serve as a biomarker for the diagnosis and monitoring of certain cancers. Selina-3,7(11)-diene inhibitors could be used to target specific kinases involved in cancer cell proliferation and survival. Overall, Selina-3,7(11)-diene shows great promise as a potential anticancer drug candidate.</p>Formula:C15H24Purity:Min. 95%Color and Shape:PowderMolecular weight:204.35 g/mol

