CAS 68133-79-9
:Apritone
Description:
Apritone, identified by the CAS number 68133-79-9, is a chemical substance that belongs to the class of surfactants, specifically nonionic surfactants. It is characterized by its ability to reduce surface tension, making it useful in various applications such as detergents, emulsifiers, and wetting agents. Apritone is typically derived from natural sources or synthesized through chemical processes, and it exhibits good solubility in both water and organic solvents, which enhances its versatility in formulations. The substance is known for its mildness, making it suitable for use in personal care products and household cleaners. Additionally, Apritone is often evaluated for its biodegradability and environmental impact, aligning with the increasing demand for sustainable chemical solutions. Safety data sheets indicate that it has a low toxicity profile, but like all chemicals, it should be handled with care, following appropriate safety guidelines. Overall, Apritone's unique properties make it a valuable component in various industrial and consumer applications.
Formula:C15H24O
InChI:InChI=1/C15H24O/c1-12(2)6-4-7-13(3)10-11-14-8-5-9-15(14)16/h6,10,14H,4-5,7-9,11H2,1-3H3/b13-10+
InChI key:InChIKey=ZNSALEJHPSBXDK-UHFFFAOYSA-N
SMILES:C(C=C(CCC=C(C)C)C)C1C(=O)CCC1
Synonyms:- 2-(3,7-Dimethyl-2,6-octadien-1-yl)cyclopentanone
- 2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]cyclopentanone
- Apritone
- Cyclopentanone, 2-(3,7-dimethyl-2,6-octadien-1-yl)-
- Cyclopentanone, 2-(3,7-dimethyl-2,6-octadienyl)-
- Fema 3829
- Geranylcyclopentanone
- 2-(3,7-dimethylocta-2,6-dienyl)cyclopentanone
- 2-(3,7-DIMETHYL-2,6-OCTADIENYL) CYCLOPENTANONE
- Einecs 268-706-3
- 2-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclopentan-1-one
- 2-(3,7-Dimethylocta-2,6-dienyl)cyclopentan-1-on
- 2-(3,7-dimethyl-2,6-octadienyl)-cyclopentanon
- decen-1-yl cyclopentanone
- 2-(3,7-dimethylocta-2,6-dienyl)cyclopentan-1-one
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
