
CAS 68134-81-6
:Gacyclidine
Description:
Gacyclidine, with the CAS number 68134-81-6, is a chemical compound that belongs to the class of substances known as NMDA receptor antagonists. It is primarily recognized for its potential applications in the field of neuroscience and pharmacology, particularly in the modulation of pain and the treatment of various neurological disorders. Gacyclidine exhibits a unique mechanism of action by selectively inhibiting the NMDA receptor, which plays a crucial role in synaptic plasticity and memory function. This compound is characterized by its ability to influence glutamatergic neurotransmission, potentially leading to analgesic effects. Additionally, Gacyclidine has been studied for its impact on cognitive functions and its neuroprotective properties. Its chemical structure includes specific functional groups that contribute to its pharmacological activity. As with many compounds in this category, further research is necessary to fully understand its therapeutic potential and safety profile in clinical applications.
Formula:C16H25NS
InChI:InChI=1/C16H25NS/c1-14-8-3-4-10-16(14,15-9-7-13-18-15)17-11-5-2-6-12-17/h7,9,13-14H,2-6,8,10-12H2,1H3/t14-,16+/s2
InChI key:InChIKey=DKFAAPPUYWQKKF-AQPSWHTGNA-N
SMILES:C[C@H]1[C@@](CCCC1)(C2=CC=CS2)N3CCCCC3
Synonyms:- 1-[(1R,2S)-2-methyl-1-(thiophen-2-yl)cyclohexyl]piperidine
- GK 11
- Piperidine, 1-[2-methyl-1-(2-thienyl)cyclohexyl]-, cis-
- Gacyclidine
- rel-1-[(1R,2S)-2-Methyl-1-(2-thienyl)cyclohexyl]piperidine
- Piperidine, 1-[(1R,2S)-2-methyl-1-(2-thienyl)cyclohexyl]-, rel-
- GK-11
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

