
CAS 68140-43-2
:3-[2-(Acetyloxy)ethoxy]phenol
Description:
3-[2-(Acetyloxy)ethoxy]phenol, identified by its CAS number 68140-43-2, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features an ethoxy group (-OCH2CH2-) and an acetyloxy group (-OCOCH3) that contribute to its chemical reactivity and solubility properties. The presence of the acetyloxy group suggests that it may undergo hydrolysis to release acetic acid, which can influence its behavior in various chemical environments. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical and agrochemical applications. Additionally, the molecular structure indicates potential for hydrogen bonding due to the hydroxyl group, which can affect its physical properties such as melting point and solubility in polar solvents. Overall, 3-[2-(Acetyloxy)ethoxy]phenol is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-8(11)13-5-6-14-10-4-2-3-9(12)7-10/h2-4,7,12H,5-6H2,1H3
InChI key:InChIKey=ZYRWJVKYFMVBHB-UHFFFAOYSA-N
SMILES:O(CCOC(C)=O)C1=CC(O)=CC=C1
Synonyms:- 3-[2-(Acetyloxy)ethoxy]phenol
- Phenol, 3-[2-(acetyloxy)ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenol, 3-(2-(acetyloxy)ethoxy)-
CAS:<p>Phenol, 3-(2-(acetyloxy)ethoxy)- is a bioactive chemical.</p>Formula:C10H12O4Color and Shape:SolidMolecular weight:196.2
