CAS 681481-94-7

1,1′-Spirobi[1H-indene]-7,7′-diol, 4,4′-dibromo-2,2′,3,3′-tetrahydro-, (1R)-

Description:

1,1′-Spirobi[1H-indene]-7,7′-diol, 4,4′-dibromo-2,2′,3,3′-tetrahydro-, (1R)-, identified by its CAS number 681481-94-7, is a complex organic compound characterized by its unique spirobicyclic structure. This compound features a spiro linkage between two indene units, which contributes to its rigidity and potential for interesting stereochemical properties. The presence of hydroxyl (-OH) groups indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The dibromo substituents enhance its electrophilic character, making it potentially useful in various chemical reactions, including cross-coupling and substitution reactions. Additionally, the specific stereochemistry denoted by (1R) suggests a particular spatial arrangement of atoms, which can affect the compound's biological activity and interaction with other molecules. Overall, this compound may have applications in materials science, organic synthesis, and potentially in medicinal chemistry, depending on its biological properties and reactivity.

Formula: C₁₇H₁₄Br₂O₂

InChI: InChI=1S/C17H14Br2O2/c18-11-1-3-13(20)15-9(11)5-7-17(15)8-6-10-12(19)2-4-14(21)16(10)17/h1-4,20-21H,5-8H2

InChI key: InChIKey=OZVMVFKUNSNXQC-UHFFFAOYSA-N

SMILES: OC1=C2C3(C=4C(CC3)=C(Br)C=CC4O)CCC2=C(Br)C=C1

Synonyms:

• 1,1′-Spirobi[1H-indene]-7,7′-diol, 4,4′-dibromo-2,2′,3,3′-tetrahydro-, (1R)-

(R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol

CAS: 681481-94-7

Formula: C₁₇H₁₄Br₂O₂

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 410.11

Ref: 3B-D4717