CAS 681482-58-6: 4-[4-(Trifluoromethyl)phenyl]-1-piperazineethanamine
Description:4-[4-(Trifluoromethyl)phenyl]-1-piperazineethanamine, with the CAS number 681482-58-6, is a chemical compound characterized by its unique structural features, including a piperazine ring and a trifluoromethyl group attached to a phenyl moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders. Additionally, the compound's stability and reactivity may be influenced by the electronic effects of the trifluoromethyl group, which can modulate interactions with biological targets. Overall, this compound represents a class of molecules that are valuable in research and development within the field of organic and medicinal chemistry.
Formula:C13H18F3N3
InChI:InChI=1S/C13H18F3N3/c14-13(15,16)11-1-3-12(4-2-11)19-9-7-18(6-5-17)8-10-19/h1-4H,5-10,17H2
InChI key:InChIKey=KEIBFAJNDBJABS-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC=C(C=C1)N2CCN(CCN)CC2
- Synonyms:
- 4-[4-(Trifluoromethyl)phenyl]-1-piperazineethanamine
- 1-Piperazineethanamine, 4-[4-(trifluoromethyl)phenyl]-
- 2-[4-[4-(Trifluoromethyl)phenyl]piperazin-1-yl]ethan-1-amine
