CAS 68160-71-4
:1-(2-nitro-1H-imidazol-1-yl)-3-[(1E)-prop-1-en-1-yloxy]propan-2-ol
Description:
1-(2-nitro-1H-imidazol-1-yl)-3-[(1E)-prop-1-en-1-yloxy]propan-2-ol, with the CAS number 68160-71-4, is a chemical compound characterized by its complex structure that includes an imidazole ring and a prop-1-en-1-yloxy group. This compound features a nitro substituent on the imidazole, which can influence its reactivity and biological activity. The presence of the hydroxyl group (propan-2-ol) suggests potential for hydrogen bonding, which may enhance solubility in polar solvents. The compound's structure indicates it may exhibit interesting pharmacological properties, particularly in medicinal chemistry, where imidazole derivatives are often explored for their antimicrobial and anticancer activities. Additionally, the presence of the prop-1-en-1-yloxy moiety may provide opportunities for further chemical modifications or reactions, making it a versatile intermediate in organic synthesis. Overall, this compound's unique features position it as a subject of interest in both research and potential applications in pharmaceuticals.
Formula:C9H13N3O4
InChI:InChI=1/C9H13N3O4/c1-2-5-16-7-8(13)6-11-4-3-10-9(11)12(14)15/h2-5,8,13H,6-7H2,1H3/b5-2+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ro 07-1902
CAS:Ro 07-1902 could enhance the effect of specific antineoplastic agents.Formula:C9H13N3O4Color and Shape:SolidMolecular weight:227.22
