CAS 68161-58-0

5-[(3-methoxyphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione

Description:

5-[(3-Methoxyphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a methoxy-substituted phenyl group attached to an amino group, contributing to its potential biological activity. The thiadiazole moiety is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's reactivity and stability. The molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. Overall, this compound represents a class of thiadiazole derivatives that may have applications in drug development and other chemical research fields.

Formula: C₉H₉N₃OS₂

InChI: InChI=1/C9H9N3OS2/c1-13-7-4-2-3-6(5-7)10-8-11-12-9(14)15-8/h2-5H,1H3,(H,10,11)(H,12,14)

SMILES: COc1cccc(c1)N=c1[nH]nc(S)s1

Synonyms:

• 1,3,4-Thiadiazole-2-Thiol, 5-[(3-Methoxyphenyl)Amino]-
• 5-(3-Methoxyanilino)-1,3,4-Thiadiazole-2-Thiol
• 5-[(3-Methoxyphenyl)amino]-1,3,4-thiadiazole-2-thiol

5-[(3-Methoxyphenyl)amino]-1,3,4-thiadiazole-2-thiol

CAS: 68161-58-0

5-[(3-Methoxyphenyl)amino]-1,3,4-thiadiazole-2-thiol (MTT) is an elastomer that is used for surface modification and as a monomer. It has been shown to be a conditioner for polyethylene terephthalate (PET), polyurethane, and polyvinyl chloride (PVC). MTT has also been used in the preparation of organic halide polymers. This polymer can be prepared by radical polymerization with hydroxyl groups on the backbone. The hydroxyl group can react with the active hydrogen of an ester to produce an alcohol or amine. The product of this reaction is called an organohydrogenpolymer. If this polymer is a hydroxyl copolymer, it can be modified by the addition of functional groups such as carboxylic acids or amines.

Formula: C₉H₉N₃OS₂

Purity: Min. 95%

Molecular weight: 239.3 g/mol

Ref: 3D-TCA16158