CAS 68161-60-4

5-[(4-ethoxyphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione

Description:

5-[(4-Ethoxyphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features an ethoxy group attached to a phenyl ring, which is further substituted by an amino group, contributing to its potential biological activity. The thiadiazole moiety is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's reactivity and stability. This substance may exhibit solubility in organic solvents, and its properties can be affected by the presence of substituents on the aromatic ring. Overall, 5-[(4-ethoxyphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione represents a class of compounds that are of interest in medicinal chemistry for their potential therapeutic applications.

Formula: C₁₀H₁₁N₃OS₂

InChI: InChI=1/C10H11N3OS2/c1-2-14-8-5-3-7(4-6-8)11-9-12-13-10(15)16-9/h3-6H,2H2,1H3,(H,11,12)(H,13,15)

SMILES: CCOc1ccc(cc1)Nc1nnc(S)s1

Synonyms:

• 1,3,4-thiadiazole-2(3H)-thione, 5-[(4-ethoxyphenyl)amino]-
• 1,3,4-Thiadiazole-2-Thiol, 5-[(4-Ethoxyphenyl)Amino]-
• 5-(4-Ethoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol
• 5-[(4-Ethoxyphenyl)Amino]-1,3,4-Thiadiazole-2-Thiol

5-[(4-Ethoxyphenyl)amino]-1,3,4-thiadiazole-2-thiol

CAS: 68161-60-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃OS₂

Purity: Min. 95%

Molecular weight: 253.3 g/mol

Ref: 3D-TCA16160