CAS 68166-83-6
:(+)-tert-butyl D-lactate
Description:
(+)-tert-butyl D-lactate, with the CAS number 68166-83-6, is an organic compound that belongs to the class of lactates, which are esters or salts derived from lactic acid. This compound is characterized by its chiral nature, possessing a specific stereochemistry that contributes to its biological activity. It typically appears as a colorless to pale yellow liquid with a pleasant odor. The molecular structure includes a tert-butyl group, which enhances its solubility in organic solvents while providing steric hindrance that can influence its reactivity. (+)-tert-butyl D-lactate is often used as a chiral building block in organic synthesis, particularly in the pharmaceutical industry, due to its ability to facilitate asymmetric synthesis. Additionally, it may exhibit low toxicity and is biodegradable, making it an attractive option for various applications, including in the production of biodegradable polymers. Its properties, such as boiling point and density, can vary based on purity and environmental conditions, but it is generally stable under standard laboratory conditions.
Formula:C7H14O3
InChI:InChI=1/C7H14O3/c1-5(8)6(9)10-7(2,3)4/h5,8H,1-4H3/t5-/m1/s1
SMILES:C[C@H](C(=O)OC(C)(C)C)O
Synonyms:- tert-Butyl (R)-(+)-lactate
- tert-butyl (2R)-2-hydroxypropanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-(+)-Lactic acid tert-butyl ester
CAS:Formula:C7H14O3Purity:98%Color and Shape:SolidMolecular weight:146.1843(R)-tert-Butyl 2-hydroxypropanoate
CAS:Controlled ProductApplications (R)-tert-Butyl 2-hydroxypropanoate is an intermediate used in the stereo controlled synthesis of hydroxy carboxylic acids from L-amino acids.
References Kunz, H., et al.: Tetrahedron Lett., 28, 1873 (1987)Formula:C7H14O3Color and Shape:NeatMolecular weight:146.18(+)-tert-Butyl D-lactate
CAS:(+)-tert-Butyl D-lactate is a cyclic ester that is found in plants and animals. It is structurally similar to the natural amino acids, L-aspartate and L-valine. (+)-tert-Butyl D-lactate has been used as an ancillary for the determination of DNA sequences and has been shown to have a ring opening reaction with amido groups. This product has also been used as feedstock for the production of lactates and as a component in copolymerization reactions. !--
Formula:C7H14O3Purity:Min. 95%Molecular weight:146.19 g/mol




