
CAS 68167-86-2
:2-[(2-Propen-1-yloxy)methyl]-1,4,7,10,13-pentaoxacyclopentadecane
Description:
2-[(2-Propen-1-yloxy)methyl]-1,4,7,10,13-pentaoxacyclopentadecane, with CAS number 68167-86-2, is a synthetic compound characterized by its unique structure that includes a pentaoxacyclopentadecane backbone. This compound features multiple ether linkages, which contribute to its potential solubility in polar solvents and its ability to form hydrogen bonds. The presence of the propenyl group suggests that it may participate in polymerization reactions, making it useful in various applications, including as a monomer or additive in polymer chemistry. Its molecular structure indicates that it may exhibit properties such as flexibility and low viscosity, which can be advantageous in formulations. Additionally, the compound's ether functionalities may impart stability and resistance to hydrolysis, enhancing its utility in diverse chemical environments. Overall, this compound's characteristics make it a candidate for applications in materials science, coatings, and possibly in the development of functionalized polymers.
Formula:C14H26O6
InChI:InChI=1S/C14H26O6/c1-2-3-18-12-14-13-19-9-8-16-5-4-15-6-7-17-10-11-20-14/h2,14H,1,3-13H2
InChI key:InChIKey=JYAIYYSYWTYOHN-UHFFFAOYSA-N
SMILES:C(OCC=C)C1COCCOCCOCCOCCO1
Synonyms:- allyloxymethyl-15-crown-5
- 1,4,7,10,13-Pentaoxacyclopentadecane, 2-[(2-propenyloxy)methyl]-
- 1,4,7,10,13-Pentaoxacyclopentadecane, 2-[(2-propen-1-yloxy)methyl]-
- 2-[(2-Propen-1-yloxy)methyl]-1,4,7,10,13-pentaoxacyclopentadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4,7,10,13-Pentaoxacyclopentadecane, 2-[(2-propenyloxy)methyl]-
CAS:Formula:C14H26O6Molecular weight:290.3526
