CAS 6817-81-8

O-α-D-Mannopyranosyl-(1→3)-O-α-D-mannopyranosyl-(1→2)-α-D-mannopyranose

Description:

O-α-D-Mannopyranosyl-(1→3)-O-α-D-mannopyranosyl-(1→2)-α-D-mannopyranose, with CAS number 6817-81-8, is a complex carbohydrate, specifically a disaccharide derivative of mannose. This compound features multiple glycosidic linkages, which contribute to its structural complexity and functionality. It is characterized by its sweet taste and solubility in water, typical of many sugars. The presence of multiple hydroxyl groups allows for hydrogen bonding, influencing its physical properties and interactions in biological systems. This compound is often studied in the context of glycoscience and may play a role in various biological processes, including cell recognition and signaling. Its structural configuration can affect its digestibility and metabolic pathways in organisms. Additionally, due to its carbohydrate nature, it may be involved in energy storage and supply within living cells. Overall, this substance exemplifies the intricate nature of polysaccharides and their significance in biochemistry and molecular biology.

Formula: C₁₈H₃₂O₁₆

InChI: InChI=1S/C18H32O16/c19-1-4-8(23)11(26)15(16(29)30-4)34-18-13(28)14(9(24)6(3-21)32-18)33-17-12(27)10(25)7(22)5(2-20)31-17/h4-29H,1-3H2/t4-,5-,6-,7-,8-,9-,10+,11+,12+,13+,14+,15+,16+,17-,18-/m1/s1

InChI key: InChIKey=LHAOFBCHXGZGOR-NAVBLJQLSA-N

SMILES: O([C@@H]1[C@H](O)[C@@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2O)O[C@H](CO)[C@H]1O)[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O

Synonyms:

• O-α-D-Mannopyranosyl-(1→3)-O-α-D-mannopyranosyl-(1→2)-α-D-mannopyranose
• α-D-Mannopyranose, O-α-D-mannopyranosyl-(1→3)-O-α-D-mannopyranosyl-(1→2)-

1,6-α-D-Mannotriose

CAS: 6817-81-8

Produced by the reverse hydrolysis of a mannose substrate

Formula: C₁₈H₃₂O₁₆

Purity: Min. 94 Area-%

Color and Shape: Powder

Molecular weight: 504.44 g/mol

Ref: 3D-OM10121