CAS 681812-07-7

2,6-Bis(trifluoromethyl)benzeneboronic acid

Description:

2,6-Bis(trifluoromethyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring that has two trifluoromethyl groups at the 2 and 6 positions. This compound typically exhibits high stability and solubility in polar organic solvents due to the presence of the boronic acid moiety, which can participate in various chemical reactions, including Suzuki coupling reactions, making it valuable in organic synthesis and materials science. The trifluoromethyl groups enhance the electron-withdrawing properties of the benzene ring, which can influence the reactivity and selectivity of the compound in chemical reactions. Additionally, the presence of fluorine atoms can impart unique physical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Overall, 2,6-Bis(trifluoromethyl)benzeneboronic acid is a versatile compound with applications in pharmaceuticals, agrochemicals, and advanced materials.

Formula: C₈H₅BF₆O₂

InChI: InChI=1/C8H5BF6O2/c10-7(11,12)4-2-1-3-5(8(13,14)15)6(4)9(16)17/h1-3,16-17H

SMILES: c1cc(c(c(c1)C(F)(F)F)B(O)O)C(F)(F)F

Synonyms:

• [2,6-Bis(trifluoromethyl)phenyl]boronic acid
• boronic acid, B-[2,6-bis(trifluoromethyl)phenyl]-
• (2,6-Bis(trifluoromethyl)phenyl)boronicacid

2,6-Bis(trifluoromethyl)benzeneboronic acid, 97%

CAS: 681812-07-7

2,6-Bis(trifluoromethyl)benzeneboronic acid is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item c

Formula: C₈H₅BF₆O₂

Purity: 97%

Color and Shape: Pale cream to cream to yellow, Powder

Molecular weight: 257.93

Ref: 02-L19952

(2,6-Bis(trifluoromethyl)phenyl)boronic acid

CAS: 681812-07-7

Formula: C₈H₅BF₆O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.9255

Ref: IN-DA0036LU

2,6-Bis(trifluoromethyl)benzeneboronic acid

CAS: 681812-07-7

2,6-Bis(trifluoromethyl)benzeneboronic acid

Formula: C₈H₅BF₆O₂

Purity: ≥95%

Color and Shape: slightly yellow solid

Molecular weight: 257.93g/mol

Ref: 54-PC10506

(2,6-Bis(trifluoromethyl)phenyl)boronic acid

CAS: 681812-07-7

Purity: 98%

Molecular weight: 257.9299927

Ref: 10-F691458