CAS 681812-07-7
:2,6-Bis(trifluoromethyl)benzeneboronic acid
Description:
2,6-Bis(trifluoromethyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring that has two trifluoromethyl groups at the 2 and 6 positions. This compound typically exhibits high stability and solubility in polar organic solvents due to the presence of the boronic acid moiety, which can participate in various chemical reactions, including Suzuki coupling reactions, making it valuable in organic synthesis and materials science. The trifluoromethyl groups enhance the electron-withdrawing properties of the benzene ring, which can influence the reactivity and selectivity of the compound in chemical reactions. Additionally, the presence of fluorine atoms can impart unique physical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Overall, 2,6-Bis(trifluoromethyl)benzeneboronic acid is a versatile compound with applications in pharmaceuticals, agrochemicals, and advanced materials.
Formula:C8H5BF6O2
InChI:InChI=1/C8H5BF6O2/c10-7(11,12)4-2-1-3-5(8(13,14)15)6(4)9(16)17/h1-3,16-17H
SMILES:c1cc(c(c(c1)C(F)(F)F)B(O)O)C(F)(F)F
Synonyms:- [2,6-Bis(trifluoromethyl)phenyl]boronic acid
- boronic acid, B-[2,6-bis(trifluoromethyl)phenyl]-
- (2,6-Bis(trifluoromethyl)phenyl)boronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Bis(trifluoromethyl)benzeneboronic acid, 97%
CAS:2,6-Bis(trifluoromethyl)benzeneboronic acid is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item cFormula:C8H5BF6O2Purity:97%Color and Shape:Pale cream to cream to yellow, PowderMolecular weight:257.93(2,6-Bis(trifluoromethyl)phenyl)boronic acid
CAS:Formula:C8H5BF6O2Purity:97%Color and Shape:SolidMolecular weight:257.92552,6-Bis(trifluoromethyl)benzeneboronic acid
CAS:2,6-Bis(trifluoromethyl)benzeneboronic acidFormula:C8H5BF6O2Purity:≥95%Color and Shape: slightly yellow solidMolecular weight:257.93g/mol



