CAS 6819-07-4
:4-nitrophenyl 4-O-beta-D-xylopyranosyl-beta-D-xylopyranoside
Description:
4-Nitrophenyl 4-O-beta-D-xylopyranosyl-beta-D-xylopyranoside is a glycoside compound characterized by the presence of a nitrophenyl group and two xylopyranosyl units. This compound features a beta-D-xylopyranosyl moiety linked to a 4-nitrophenyl group, which contributes to its solubility and reactivity. The presence of the nitro group typically imparts certain electronic properties, making it useful in various chemical reactions, including those involving nucleophiles. Glycosides like this one are often studied for their biological activities, including potential applications in pharmaceuticals and biochemistry. The compound is soluble in polar solvents, and its structure allows for interactions with enzymes, making it a subject of interest in glycoscience. Additionally, the specific stereochemistry of the glycosidic bond influences its enzymatic hydrolysis and biological function. Overall, 4-nitrophenyl 4-O-beta-D-xylopyranosyl-beta-D-xylopyranoside serves as a valuable model for studying glycosidic linkages and their properties in chemical and biological contexts.
Formula:C16H21NO11
InChI:InChI=1/C16H21NO11/c18-9-5-25-16(13(21)11(9)19)28-10-6-26-15(14(22)12(10)20)27-8-3-1-7(2-4-8)17(23)24/h1-4,9-16,18-22H,5-6H2/t9-,10-,11+,12+,13-,14-,15+,16+/m1/s1
Synonyms:- beta-D-xylopyranoside, 4-nitrophenyl 4-O-beta-D-xylopyranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Nitrophenyl β-D-xylobioside
CAS:4-Nitrophenyl beta-D-xylobioside is a chromogenic substrate for xylanase. Upon hydrolysis, para-nitrophenol is released yielding a yellowish colour. 4-Nitrophenyl beta-D-xylobioside is used in different applications such as the Xylan degradation studies, paper/pulp industry applicationsFormula:C16H21NO11Purity:Min. 95%Color and Shape:White PowderMolecular weight:403.34 g/molRef: 3D-EN15454
Discontinued product
