CAS 682-80-4
:Demephion-O
Description:
Demephion-O, with the CAS number 682-80-4, is an organophosphorus compound primarily used as an insecticide and acaricide in agricultural applications. It is characterized by its ability to inhibit acetylcholinesterase, an enzyme crucial for the proper functioning of the nervous system in insects, leading to their paralysis and death. Demephion-O is typically a colorless to pale yellow liquid with a distinctive odor. Its chemical structure includes a phosphorus atom bonded to various functional groups, contributing to its biological activity. The compound is moderately soluble in organic solvents but has limited solubility in water, which affects its application and environmental behavior. Safety precautions are necessary when handling Demephion-O, as it can be toxic to humans and non-target organisms. Proper protective equipment should be used to minimize exposure, and it is essential to follow regulatory guidelines for its use in agricultural settings to mitigate potential environmental impacts.
Formula:C5H13O3PS2
InChI:InChI=1S/C5H13O3PS2/c1-6-9(10,7-2)8-4-5-11-3/h4-5H2,1-3H3
InChI key:InChIKey=IATBEFPCSHFQJS-UHFFFAOYSA-N
SMILES:P(OCCSC)(OC)(OC)=S
Synonyms:- Demephion-O
- Phosphorothioic acid, O,O-dimethyl O-[2-(methylthio)ethyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Demephion-O
CAS:Controlled ProductFormula:C5H13O3PS2Color and Shape:Colourless To Light YellowMolecular weight:216.26
