CAS 68208-16-2

3-amino-3-(2-methylphenyl)propanoic acid

Description:

3-Amino-3-(2-methylphenyl)propanoic acid, also known by its CAS number 68208-16-2, is an amino acid derivative characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a propanoic acid backbone. The molecule features a 2-methylphenyl group, which contributes to its hydrophobic characteristics and influences its solubility and reactivity. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. It may exhibit both acidic and basic properties, allowing it to participate in various chemical reactions, including peptide bond formation. The presence of the aromatic ring can also affect its biological activity, making it of interest in pharmaceutical and biochemical research. Overall, 3-amino-3-(2-methylphenyl)propanoic acid is a versatile compound with potential applications in drug development and as a biochemical probe.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c1-7-4-2-3-5-8(7)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)

SMILES: Cc1ccccc1C(CC(=O)O)N

Synonyms:

• Benzenepropanoic Acid, Beta-Amino-2-Methyl-

3-Amino-3-(2-methylphenyl)propanoic acid

CAS: 68208-16-2

Formula: C₁₀H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.2157

Ref: IN-DA005YLA

3-Amino-3-(o-tolyl)propanoic acid

CAS: 68208-16-2

3-Amino-3-(o-tolyl)propanoic acid

Purity: 97%

Molecular weight: 179.22g/mol

Ref: 54-OR75887

3-Amino-3-(o-tolyl)propanoic acid

CAS: 68208-16-2

Purity: 97%

Molecular weight: 179.2189941

Ref: 10-F689721

β-Amino-2-methylbenzenepropanoic Acid

Controlled Product

CAS: 68208-16-2

Formula: C₁₀H₁₃NO₂

Color and Shape: Neat

Molecular weight: 179.216

Ref: TR-A614105