CAS 68208-17-3

3-Amino-3-(3-methylphenyl)propanoic acid

Description:

3-Amino-3-(3-methylphenyl)propanoic acid, also known as a derivative of amino acids, features a propanoic acid backbone with an amino group and a 3-methylphenyl substituent. This compound is characterized by its structural formula, which includes a central carbon atom bonded to an amino group (-NH2), a carboxylic acid group (-COOH), and a phenyl ring with a methyl group at the meta position. The presence of the amino and carboxylic acid functional groups makes it an α-amino acid, contributing to its potential role in biological systems, such as protein synthesis or as a neurotransmitter precursor. The compound is likely to exhibit polar characteristics due to the functional groups, influencing its solubility in water and organic solvents. Additionally, it may participate in various chemical reactions typical of amino acids, such as peptide bond formation. Its specific applications and biological activity would depend on further studies, but it may have relevance in pharmaceutical or biochemical research contexts.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c1-7-3-2-4-8(5-7)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)

SMILES: Cc1cccc(c1)C(CC(=O)O)N

Synonyms:

• Benzenepropanoic acid, beta-amino-3-methyl-
• 3-Amino-3-M-Tolyl-Propionic Acid

3-Amino-3-(m-tolyl)propanoic acid

CAS: 68208-17-3

Formula: C₁₀H₁₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.2157

Ref: IN-DA005YL9

3-Amino-3-(m-tolyl)propanoic acid

CAS: 68208-17-3

3-Amino-3-(m-tolyl)propanoic acid

Purity: 97%

Molecular weight: 179.22g/mol

Ref: 54-OR89716

DL-β-(m-Tolyl)alanine

CAS: 68208-17-3

Formula: C₁₀H₁₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.219

Ref: 10-F040341