CAS 68208-23-1

3-Amino-3-(4-methylphenyl)propan-1-ol

Description:

3-Amino-3-(4-methylphenyl)propan-1-ol, with the CAS number 68208-23-1, is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a propan-1-ol backbone. This compound features a 4-methylphenyl group, which contributes to its aromatic characteristics and influences its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both the amino and hydroxyl functional groups suggests that it may exhibit properties such as hydrogen bonding, which can affect its solubility in polar solvents like water. Additionally, this compound may have applications in pharmaceuticals or as a building block in organic synthesis due to its functional groups, which can participate in various chemical reactions. Its stability, reactivity, and potential biological activity would depend on the specific conditions under which it is used or studied.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-8-2-4-9(5-3-8)10(11)6-7-12/h2-5,10,12H,6-7,11H2,1H3

SMILES: Cc1ccc(cc1)C(CCO)N

Synonyms:

• Benzenepropanol, γ-amino-4-methyl-

3-Amino-3-p-tolyl-propan-1-ol

CAS: 68208-23-1

Formula: C₁₀H₁₅NO

Molecular weight: 165.2322

Ref: IN-DA005LVF

DL-ß-3-p-Tolylalaninol

CAS: 68208-23-1

Formula: C₁₀H₁₅NO

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 165.236

Ref: 10-F034498

DL-beta-3-p-tolylalaninol

CAS: 68208-23-1

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-TCA20823