CAS 68211-15-4
:6-bromo-4-chlorocinnoline
Description:
6-Bromo-4-chlorocinnoline is a heterocyclic organic compound characterized by its fused ring structure, which includes both a cinnoline and halogen substituents. The presence of bromine and chlorine atoms introduces significant reactivity and influences its chemical properties, such as polarity and solubility. Typically, compounds like 6-bromo-4-chlorocinnoline exhibit moderate to high stability under standard conditions but may undergo reactions such as electrophilic substitution or nucleophilic attack due to the electron-withdrawing nature of the halogens. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. Additionally, its unique structure may impart specific optical or electronic properties, making it suitable for applications in organic electronics or as a precursor in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C8H4BrClN2
InChI:InChI=1/C8H4BrClN2/c9-5-1-2-8-6(3-5)7(10)4-11-12-8/h1-4H
SMILES:c1cc2c(cc1Br)c(cnn2)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-BROMO-4-CHLOROCINNOLINE
CAS:Formula:C8H4BrClN2Purity:95%Color and Shape:SolidMolecular weight:243.48786-Bromo-4-chlorocinnoline
CAS:6-Bromo-4-chlorocinnoline is a versatile building block that can be used as a reaction component, reagent, or speciality chemical. It can be converted into other useful compounds with the help of various reactions. 6-Bromo-4-chlorocinnoline is a fine chemical that is a useful scaffold for the synthesis of complex compounds. This compound has been shown to react with amines to form ureas and with nitriles to form azides.Formula:C8H4BrClN2Purity:Min. 95%Color and Shape:PowderMolecular weight:243.5 g/mol6-Bromo-4-chlorocinnoline
CAS:Formula:C8H4BrClN2Purity:95%Color and Shape:SolidMolecular weight:243.49



