
CAS 68213-98-9
:2-[[2-(2-Hydroxyethoxy)ethyl]methylamino]ethanol
Description:
2-[[2-(2-Hydroxyethoxy)ethyl]methylamino]ethanol, with the CAS number 68213-98-9, is a chemical compound characterized by its structure, which includes a hydroxyl group and an amino group. This compound is typically classified as an amine due to the presence of the amino functional group, which can participate in hydrogen bonding, enhancing its solubility in water. The presence of ethoxy and hydroxy groups suggests that it may exhibit surfactant properties, making it useful in various applications, including as a solvent or in formulations for personal care products. Its molecular structure indicates potential for interaction with biological systems, which may influence its behavior in pharmaceutical or cosmetic applications. Additionally, the compound's hydrophilic characteristics may contribute to its effectiveness in emulsifying or stabilizing mixtures. Safety and handling considerations should be taken into account, as with any chemical substance, to ensure proper usage and minimize exposure risks.
Formula:C7H17NO3
InChI:InChI=1S/C7H17NO3/c1-8(2-4-9)3-6-11-7-5-10/h9-10H,2-7H2,1H3
InChI key:InChIKey=DHFGYXVVIQTUSZ-UHFFFAOYSA-N
SMILES:N(CCOCCO)(CCO)C
Synonyms:- 2-[[2-(2-Hydroxyethoxy)ethyl]methylamino]ethanol
- 2-[[2-(2-Hydroxyethoxy)ethyl](methyl)amino]ethan-1-ol
- Ethanol, 2-[2-[(2-hydroxyethyl)methylamino]ethoxy]-
- Ethanol, 2-[[2-(2-hydroxyethoxy)ethyl]methylamino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.