CymitQuimica logo

CAS 68223-03-0

:

Z-D-MeAla-OH

Description:
Z-D-MeAla-OH, also known as Z-Dimethylalanine, is a chemical compound characterized by its structure, which includes a Z (benzyloxycarbonyl) protecting group on the amino group of the amino acid dimethylalanine. This compound is typically used in peptide synthesis and as an intermediate in the production of various pharmaceuticals. The presence of the Z group enhances the stability and solubility of the compound, making it easier to handle during chemical reactions. Z-D-MeAla-OH is a chiral molecule, which means it exists in two enantiomeric forms, contributing to its potential applications in asymmetric synthesis. The compound is generally soluble in organic solvents and exhibits typical properties of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions. Its CAS number, 68223-03-0, is a unique identifier that facilitates the identification and sourcing of this compound in chemical databases and literature.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c1-9(11(14)15)13(2)12(16)17-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,14,15)/t9-/m1/s1
InChI key:QGEQKVZQPWSOTI-SECBINFHSA-N
SMILES:C[C@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1
Found 4 products.