CAS 68223-13-2

4-(pyridin-3-yl)phenol

Description:

4-(Pyridin-3-yl)phenol, also known by its CAS number 68223-13-2, is an organic compound characterized by the presence of both a phenolic group and a pyridine ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The molecular structure features a hydroxyl (-OH) group attached to a phenyl ring, which is further substituted with a pyridine moiety at the para position. This configuration contributes to its potential biological activity, making it of interest in medicinal chemistry and material science. The compound may exhibit properties such as antioxidant activity, and it can participate in various chemical reactions, including electrophilic substitutions and hydrogen bonding due to the presence of the hydroxyl group. Additionally, its unique structure allows for interactions with biological targets, which can be explored for therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₉NO

InChI: InChI=1/C11H9NO/c13-11-5-3-9(4-6-11)10-2-1-7-12-8-10/h1-8,13H

SMILES: c1cc(cnc1)c1ccc(cc1)O

Synonyms:

• Phenol, 4-(3-Pyridinyl)-

4-(Pyridin-3-yl)phenol

CAS: 68223-13-2

Formula: C₁₁H₉NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.1953

Ref: IN-DA00FFWX

4-Pyridin-3-ylphenol

CAS: 68223-13-2

Purity: ≥95%

Molecular weight: 171.1990051

Ref: 10-F609536

4-(pyridin-3-yl)phenol

Controlled Product

CAS: 68223-13-2

Formula: C₁₁H₉NO

Color and Shape: Neat

Molecular weight: 171.195

Ref: TR-P993775