CAS 68239-06-5

2-Heptyl-3,4-bis(9-isocyanatononyl)-1-pentylcyclohexane

Description:

2-Heptyl-3,4-bis(9-isocyanatononyl)-1-pentylcyclohexane, with the CAS number 68239-06-5, is a complex organic compound characterized by its unique structure that includes a cyclohexane ring substituted with multiple alkyl and isocyanate groups. This compound is likely to exhibit properties typical of polyisocyanates, such as high reactivity, particularly in the presence of moisture, leading to the formation of polyurethanes. Its molecular structure suggests it may have significant hydrophobic characteristics due to the long alkyl chains, which can influence its solubility and interaction with other substances. Additionally, the presence of isocyanate groups indicates potential applications in the production of coatings, adhesives, and foams, as these groups are known for their ability to react with alcohols and amines. Safety considerations are paramount, as isocyanates are known to be irritants and can pose health risks upon exposure. Overall, this compound's unique structure and functional groups contribute to its potential utility in various industrial applications while necessitating careful handling.

Formula: C₃₈H₇₀N₂O₂

InChI: InChI=1S/C38H70N2O2/c1-3-5-7-14-21-27-37-35(25-19-6-4-2)29-30-36(26-20-15-10-8-12-17-23-31-39-33-41)38(37)28-22-16-11-9-13-18-24-32-40-34-42/h35-38H,3-32H2,1-2H3

InChI key: InChIKey=AMUBKBXGFDIMDJ-UHFFFAOYSA-N

SMILES: C(CCCCCCCCN=C=O)C1C(CCCCCCC)C(CCCCC)CCC1CCCCCCCCCN=C=O

Synonyms:

• Cyclohexane, 2-heptyl-3,4-bis(9-isocyanatononyl)-1-pentyl-
• 2-Heptyl-3,4-bis(9-isocyanatononyl)-1-pentylcyclohexane

2-Heptyl-3,4-bis(9-isocyanatononyl)-1-pentylcyclohexane

CAS: 68239-06-5

Please enquire for more information about 2-Heptyl-3,4-bis(9-isocyanatononyl)-1-pentylcyclohexane including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₃₈H₇₀N₂O₂

Purity: Viscosity <130Mpa.S

Molecular weight: 586.98 g/mol

Ref: 3D-FH184116