CAS 68259-11-0
:Pentanoic acid, 2,2,3,3,4,4,5,5,5-nonafluoro-, ammonium salt (1:1)
Description:
Pentanoic acid, 2,2,3,3,4,4,5,5,5-nonafluoro-, ammonium salt (1:1), with CAS number 68259-11-0, is a fluorinated carboxylic acid derivative characterized by its unique structure that includes multiple fluorine atoms attached to a pentanoic acid backbone. This compound typically exhibits high thermal stability and low volatility due to the presence of fluorine, which enhances its chemical resistance and hydrophobic properties. As an ammonium salt, it is likely to be soluble in polar solvents, such as water, and may exhibit surfactant properties, making it useful in various applications, including emulsifiers and dispersants. The presence of fluorine atoms can also impart unique biological and environmental behavior, potentially affecting its toxicity and biodegradability. Overall, this compound is of interest in fields such as materials science, pharmaceuticals, and environmental chemistry due to its distinctive properties and potential applications.
Formula:C5HF9O2·H3N
InChI:InChI=1S/C5HF9O2.H3N/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14;/h(H,15,16);1H3
InChI key:InChIKey=QGKJZVRFHDAXTC-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(F)F)(C(C(O)=O)(F)F)(F)F.N
Synonyms:- Pentanoic acid, 2,2,3,3,4,4,5,5,5-nonafluoro-, ammonium salt (1:1)
- Nonafluoropentanoic acid, ammonium salt
- Pentanoic acid, nonafluoro-, ammonium salt
- Nonafluoropentanoic Acid Ammoniate (1:1)
- Ammonium perfluorovalerate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
