CAS 68262-20-4
:3-(3-methoxyphenyl)-2-oxopropanoic acid
Description:
3-(3-Methoxyphenyl)-2-oxopropanoic acid, with the CAS number 68262-20-4, is an organic compound characterized by its structure, which includes a propanoic acid moiety with a ketone functional group and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in organic solvents and potential reactivity in various chemical reactions, including esterification and acylation. The presence of the methoxy group can influence its electronic properties, potentially enhancing its reactivity or affecting its interaction with biological systems. Additionally, compounds of this type may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests that it may participate in hydrogen bonding due to the carboxylic acid group, which can affect its physical properties, such as melting point and boiling point. Overall, 3-(3-methoxyphenyl)-2-oxopropanoic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5H,6H2,1H3,(H,12,13)
SMILES:COc1cccc(c1)CC(=O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(3-Methoxyphenyl)-2-oxopropanoic acid
CAS:3-(3-Methoxyphenyl)-2-oxopropanoic acidPurity:97%Molecular weight:194.19g/molRef: 10-F663973
50mg120.00€100mg160.00€250mg223.00€500mg410.00€1g492.00€2.5g1,150.00€5g1,309.00€10g2,617.00€3-(3-Methoxyphenyl)-2-oxopropanoic acid
CAS:Vanillic acid is a phenolic compound that can be found in vanilla and other plants. It is an important precursor for the synthesis of aromatic compounds such as ferulic acid, lignin, and coumarin. Vanillic acid has been shown to have a variety of biochemical and chemists properties, including the ability to aromatize, which means it can be used in the preparation of synthetic hormones. This compound also acts as an antioxidant by scavenging reactive oxygen species. Vanillic acid is found in two sources: pre-existing vanillin (from plants) and ferulic acid (from microbial metabolism). Vanillin is derived from coniferyl alcohol and coniferaldehyde, which are both found in poria. Ferulic acid is produced by polyporus fungi and can be converted into vanillic acid via decarboxylation.Formula:C10H10O4Purity:Min. 95%Molecular weight:194.18 g/molRef: 3D-TCA26220
Discontinued product


