CAS 682802-82-0
:6-(Phenylmethoxy)-1H-indole-3-acetic acid
Description:
6-(Phenylmethoxy)-1H-indole-3-acetic acid, identified by its CAS number 682802-82-0, is a chemical compound that belongs to the indole family, characterized by the presence of an indole ring structure. This compound features a phenylmethoxy group, which contributes to its unique properties and potential biological activities. Typically, indole derivatives are known for their diverse pharmacological effects, including anti-inflammatory, analgesic, and potential anticancer activities. The presence of the acetic acid moiety suggests that this compound may exhibit interactions with biological systems, possibly influencing metabolic pathways or receptor activities. Its solubility and stability can vary depending on the pH and solvent conditions, which are crucial for its application in research or therapeutic contexts. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral data would be essential for practical applications and further studies. Overall, 6-(Phenylmethoxy)-1H-indole-3-acetic acid represents a compound of interest in medicinal chemistry and pharmacology.
Formula:C17H15NO3
InChI:InChI=1S/C17H15NO3/c19-17(20)8-13-10-18-16-9-14(6-7-15(13)16)21-11-12-4-2-1-3-5-12/h1-7,9-10,18H,8,11H2,(H,19,20)
InChI key:InChIKey=PHNNDRRSUHPAFS-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(=CC(OCC3=CC=CC=C3)=CC2)NC1
Synonyms:- 1H-Indole-3-acetic acid, 6-(phenylmethoxy)-
- 6-(Phenylmethoxy)-1H-indole-3-acetic acid
- 2-[6-(Benzyloxy)-1H-indol-3-yl]acetic acid
- [6-[(Benzyl)oxy]indol-3-yl]acetic acid
- 2-(6-(Benzyloxy)-1H-indol-3-yl)aceticacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Benzyloxyindole-3-acetic acid
CAS:6-Benzyloxyindole-3-acetic acid is a versatile building block and reagent that can be used in the synthesis of complex organic compounds. It is an intermediate in organic synthesis and has been shown to be useful as a scaffold for drug discovery. 6-Benzyloxyindole-3-acetic acid is also used as a research chemical, especially in the study of DNA repair mechanisms. This compound is registered under CAS No. 682802-82-0 and has a purity of 99%.
Formula:C17H15NO3Molecular weight:281.31 g/molRef: 3D-B-1752
Discontinued product6-Benzyloxyindole-3-acetic acid
CAS:Please enquire for more information about 6-Benzyloxyindole-3-acetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C17H15NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:281.31 g/mol


