CAS 682802-87-5

1H-Indole-3,5-dicarboxaldehyde

Description:

1H-Indole-3,5-dicarboxaldehyde is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features two aldehyde functional groups located at the 3 and 5 positions of the indole ring, making it a dicarboxaldehyde. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The presence of the aldehyde groups allows for reactivity in various chemical reactions, including condensation and oxidation, which can be utilized in synthetic organic chemistry. Additionally, 1H-Indole-3,5-dicarboxaldehyde may exhibit biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. Its unique structure and functional groups make it a valuable compound for research in medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.

Formula: C₁₀H₇NO₂

InChI: InChI=1S/C10H7NO2/c12-5-7-1-2-10-9(3-7)8(6-13)4-11-10/h1-6,11H

InChI key: InChIKey=ZUZXRKSFCBCQIA-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(NC1)=CC=C(C=O)C2

Synonyms:

• 1H-Indole-3,5-dicarbaldehyde
• 1H-Indole-3,5-dicarboxaldehyde
• 1H-indole-3,5-dicarboxaldehyde1H-indole-3,5-dicarbaldehyde