CAS 68281-65-2

methyl 6-chloro-2H-chromene-3-carboxylate

Description:

Methyl 6-chloro-2H-chromene-3-carboxylate is an organic compound characterized by its chromene structure, which features a fused benzene and pyran ring. The presence of a chlorine atom at the 6-position and a carboxylate group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is soluble in organic solvents, which makes it useful in various chemical reactions, including esterification and nucleophilic substitutions. Methyl 6-chloro-2H-chromene-3-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, which could lead to the discovery of new therapeutic agents. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₁H₉ClO₃

InChI: InChI=1/C11H9ClO3/c1-14-11(13)8-4-7-5-9(12)2-3-10(7)15-6-8/h2-5H,6H2,1H3

SMILES: COC(=O)C1=Cc2cc(ccc2OC1)Cl

Methyl 6-chloro-2H-chromene-3-carboxylate

CAS: 68281-65-2

Formula: C₁₁H₉ClO₃

Color and Shape: Solid

Molecular weight: 224.6404

Ref: IN-DA005XEH

Methyl 6-chloro-2H-chromene-3-carboxylate

CAS: 68281-65-2

Methyl 6-chloro-2H-chromene-3-carboxylate

Purity: 95%

Molecular weight: 224.64g/mol

Ref: 54-OR32730