CAS 68282-47-3
:2-phenyl-1H-imidazole-4-carbaldehyde
Description:
2-Phenyl-1H-imidazole-4-carbaldehyde is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenyl group attached to the imidazole ring, contributing to its aromatic properties. The aldehyde functional group (-CHO) at the 4-position of the imidazole ring is significant for its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. The presence of both the imidazole and phenyl groups suggests potential applications in pharmaceuticals, particularly in the development of biologically active compounds. Additionally, this compound may exhibit interesting properties such as fluorescence or coordination with metal ions, making it of interest in materials science and coordination chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, 2-phenyl-1H-imidazole-4-carbaldehyde is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12)
SMILES:c1ccc(cc1)c1ncc(C=O)[nH]1
Synonyms:- 2-phenyl-1H-imidazole-5-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Phenyl-1H-imidazole-4-carbaldehyde
CAS:Formula:C10H8N2OPurity:97%Color and Shape:SolidMolecular weight:172.18332-Phenyl-1H-imidazole-4-carboxaldehyde
CAS:2-Phenyl-1H-imidazole-4-carboxaldehydePurity:97%Color and Shape:PowderMolecular weight:172.18332g/mol2-Phenyl-1H-imidazole-4-carbaldehyde
CAS:Formula:C10H8N2OPurity:97%Color and Shape:SolidMolecular weight:172.1872-Phenyl-1H-imidazole-4-carbaldehyde
CAS:2-Phenyl-1H-imidazole-4-carbaldehyde is an aldehyde that is used as a ligand in asymmetric synthesis. It can be used in the nitroaldol reaction to produce chiral imidazole derivatives. The compound is useful for the synthesis of molecules with high molecular weight and low reactivity, which can be further modified to produce pharmaceuticals. The compound has been shown to catalyze organic reactions, such as condensation products and stereospecific reactions.Formula:C10H8N2OPurity:Min. 95%Molecular weight:172.19 g/mol



