CAS 6829-31-8
:4-amino-1-(beta-D-arabinofuranosyl)-5-methylpyrimidin-2(1H)-one
Description:
4-amino-1-(beta-D-arabinofuranosyl)-5-methylpyrimidin-2(1H)-one, commonly known as a nucleoside analog, is characterized by its structural components that include a pyrimidine ring and an arabinofuranosyl sugar moiety. This compound features an amino group at the 4-position and a methyl group at the 5-position of the pyrimidine ring, contributing to its biological activity. It is primarily recognized for its role in antiviral and anticancer therapies, as it can interfere with nucleic acid synthesis. The presence of the beta-D-arabinofuranosyl group enhances its solubility and cellular uptake, making it more effective in biological systems. The compound's molecular structure allows it to mimic natural nucleosides, which is crucial for its function in inhibiting viral replication or cancer cell proliferation. Additionally, its CAS number, 6829-31-8, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, showcasing the importance of structural modifications in drug design.
Formula:C10H15N3O5
InChI:InChI=1/C10H15N3O5/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6-,7+,9-/m1/s1
Synonyms:- 2(1H)-Pyrimidinone, 4-amino-1-beta-D-arabinofuranosyl-5-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cytarabine EP Impurity I
CAS:Formula:C10H15N3O5Color and Shape:White To Off-White SolidMolecular weight:257.251-β-D-Arabinofuranosyl-5-methylcytosine
CAS:Controlled ProductFormula:C10H15N3O5Color and Shape:Off-WhiteMolecular weight:257.241-β-D-Arabinofuranosyl-5-methylcytosine
CAS:1-β-D-Arabinofuranosyl-5-methylcytosine is an analog of the anticancer drug indirubin that has been shown to induce apoptosis in cancer cells. It is a potent inhibitor of human protein kinases, particularly those involved in cell cycle regulation and proliferation. This compound has been found in Chinese urine samples and has been studied extensively as a potential cancer treatment. 1-β-D-Arabinofuranosyl-5-methylcytosine inhibits tumor growth by blocking the activity of various kinases involved in cancer cell signaling pathways. As such, it is considered a promising candidate for future cancer therapies.Formula:C10H15N3O5Purity:Min. 95%Molecular weight:257.24 g/mol



