CAS 68298-12-4
:N-Methylperfluorobutanesulfonamide
Description:
N-Methylperfluorobutanesulfonamide (CAS 68298-12-4) is a perfluorinated compound characterized by its sulfonamide functional group and a methyl group attached to the nitrogen atom. This compound is part of a larger class of perfluoroalkyl substances (PFAS), which are known for their unique properties, including high thermal stability, resistance to chemical degradation, and hydrophobicity. N-Methylperfluorobutanesulfonamide exhibits low surface tension and is often used in various applications, including surfactants and coatings. Its perfluorinated structure contributes to its persistence in the environment, raising concerns regarding bioaccumulation and potential toxicity. The compound is typically stable under a wide range of conditions, but its environmental impact has led to increased scrutiny and regulation. Understanding its behavior in biological and ecological systems is crucial for assessing risks associated with exposure to PFAS compounds. Overall, N-Methylperfluorobutanesulfonamide exemplifies the complex balance between utility and environmental safety in the use of synthetic chemicals.
Formula:C5H4F9NO2S
InChI:InChI=1S/C5H4F9NO2S/c1-15-18(16,17)5(13,14)3(8,9)2(6,7)4(10,11)12/h15H,1H3
InChI key:InChIKey=GFZPUWKGPNHWHD-UHFFFAOYSA-N
SMILES:C(C(S(NC)(=O)=O)(F)F)(C(C(F)(F)F)(F)F)(F)F
Synonyms:- 1,1,2,2,3,3,4,4,4-Nonafluoro-N-methyl-1-butanesulfonamide
- 1-butanesulfonamide, 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-
- Ai 3-10704
- N-(Methyl)nonafluorobutanesulfonamide
- N-(Perfluorobutylsulfonyl)-N-methylamine
- N-Methylperfluorobutanesulfonamide
- 1,1,2,2,3,3,4,4,4-Nonafluoro-N-methylbutane-1-sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Methylperfluorobutanesulfonamide
CAS:Controlled ProductFormula:C5H4F9NO2SColor and Shape:NeatMolecular weight:313.1416N-Methylperfluorobutanesulfonamide
CAS:N-MethylperfluorobutanesulfonamideFormula:C5H4F9NO2SPurity:97%Color and Shape: solidMolecular weight:313.14138g/mol1,1,2,2,3,3,4,4,4-Nonafluoro-N-methyl-1-butanesulfonamide
CAS:Controlled ProductFormula:C5H4F9NO2SColor and Shape:NeatMolecular weight:313.1416N-(Methyl)nonafluorobutanesulfonamide
CAS:Nonafluorobutanesulfonamide (NFBS) is a volatile organic solvent that is used in the manufacture of coatings and other organic chemicals. It has been shown to have a high vapor pressure, which makes it useful for drying solvents. NFBS is also used as an intermediate in the production of fluorinated acrylates and methacrylates. NFBS reacts with styrene monomers to form ionic forms, and can be converted to its neutral form by reaction with acrylonitrile or acrylates. Nonafluorobutanesulfonamide has been shown to cause liver cancer in rats, but this effect has not been observed in humans.Formula:C5H4F9NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:313.14 g/mol



