CAS 68301-75-7
:2-Amino-6-methyl-4-oxo-4H-1-benzopyran-3-carboxaldehyde
Description:
2-Amino-6-methyl-4-oxo-4H-1-benzopyran-3-carboxaldehyde, with the CAS number 68301-75-7, is a chemical compound that belongs to the class of benzopyran derivatives. This compound features a benzopyran core, which is characterized by a fused benzene and pyran ring structure. The presence of an amino group at the 2-position and a carboxaldehyde group at the 3-position contributes to its reactivity and potential biological activity. The 4-oxo group indicates the presence of a carbonyl functional group, which can participate in various chemical reactions, including condensation and nucleophilic addition. The methyl group at the 6-position can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-6-2-3-9-7(4-6)10(14)8(5-13)11(12)15-9/h2-5H,12H2,1H3
InChI key:InChIKey=ZUOLPKRXZRWAFV-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(N)=C1C=O)=CC=C(C)C2
Synonyms:- 2-Amino-6-methyl-4-oxo-4H-1-benzopyran-3-carboxaldehyde
- 2-Amino-6-methyl-4-oxochromene-3-carbaldehyde
- 4H-1-Benzopyran-3-carboxaldehyde, 2-amino-6-methyl-4-oxo-
- 2-Amino-6-methyl-4-oxo-4H-chromene-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
