CAS 68304-21-2
:8-hydroxy-2-oxo-1,2-dihydroquinoline-5-carbaldehyde
Description:
8-Hydroxy-2-oxo-1,2-dihydroquinoline-5-carbaldehyde, with the CAS number 68304-21-2, is a chemical compound that features a quinoline structure, which is characterized by a fused bicyclic system containing a benzene ring and a pyridine ring. This compound possesses a hydroxyl group (-OH) and an aldehyde group (-CHO), contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the keto group (C=O) enhances its electrophilic character, making it suitable for various chemical reactions, including condensation and nucleophilic attacks. Its unique structure allows for potential interactions with biological targets, which may lead to applications in pharmaceuticals or as a fluorescent probe. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical use in laboratory settings. Overall, 8-hydroxy-2-oxo-1,2-dihydroquinoline-5-carbaldehyde is a versatile compound with significant implications in chemical research and development.
Formula:C10H7NO3
InChI:InChI=1/C10H7NO3/c12-5-6-1-3-8(13)10-7(6)2-4-9(14)11-10/h1-5,13H,(H,11,14)
SMILES:c1cc(c2c(ccc(n2)O)c1C=O)O
Synonyms:- 5-Quinolinecarboxaldehyde, 1,2-dihydro-8-hydroxy-2-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Formyl-8-hydroxycarbostyril
CAS:Controlled ProductApplications 5-Formyl-8-hydroxycarbostyril is a metabolite of procaterol hydrochloride (Meptin), a β2-adrenergic agonist used in the treatment of asthma.
References Kobayashi, H. et al.: Int. J. Clin. Pharm. Ther., 48, 744 (2010);Formula:C10H7NO3Color and Shape:NeatMolecular weight:189.178-Hydroxy-2-oxo-1,2-dihydroquinoline-5-carbaldehyde
CAS:8-Hydroxy-2-oxo-1,2-dihydroquinoline-5-carbaldehyde is a cyclic compound that has been identified as a metabolite of quinolones such as ciprofloxacin. It is also found in human urine and faeces. The structure of 8-hydroxy-2-oxo-1,2-dihydroquinoline 5'-carbaldehyde can be determined by spectrometric methods. This compound is the product of metabolism of ciprofloxacin and other quinolones. Ciprofloxacin is a fluoroquinolone antibiotic that inhibits bacterial DNA gyrase, leading to inhibition of RNA synthesis and protein synthesis. Quinolones are also metabolized to 8-hydroxy 2 -oxo 1,2 -dihydroquinoline 5'-carbaldehyde by glucuronic acid conjugation and hydrolysis. TheFormula:C10H7NO3Purity:Min. 95%Molecular weight:189.17 g/mol



